C30H28N2O2S — CID 21377336
(5E)-5-[[2,5-dimethyl-1-(2,4,6-trimethylphenyl)pyrrol-3-yl]methylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 21377336) has the molecular formula C30H28N2O2S and a molecular weight of 480.63 g/mol. Its IUPAC name is (5E)-5-[[2,5-dimethyl-1-(2,4,6-trimethylphenyl)pyrrol-3-yl]methylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[2,5-dimethyl-1-(2,4,6-trimethylphenyl)pyrrol-3-yl]methylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 21377336 |
| Molecular Formula | C30H28N2O2S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | (5E)-5-[[2,5-dimethyl-1-(2,4,6-trimethylphenyl)pyrrol-3-yl]methylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc(C)c(-n2c(C)cc(/C=C3/SC(=O)N(Cc4cccc5ccccc45)C3=O)c2C)c(C)c1 |
| InChI | InChI=1S/C30H28N2O2S/c1-18-13-19(2)28(20(3)14-18)32-21(4)15-25(22(32)5)16-27-29(33)31(30(34)35-27)17-24-11-8-10-23-9-6-7-12-26(23)24/h6-16H,17H2,1-5H3/b27-16+ |
| InChIKey | JADNBFUDPYKEFJ-JVWAILMASA-N |
| XLogP | 7.41 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|