C22H24ClNO2 — CID 21380867
1-[1-[3-(4-chloro-3-methylphenoxy)propyl]-7-ethylindol-3-yl]ethanone (PubChem CID 21380867) has the molecular formula C22H24ClNO2 and a molecular weight of 369.89 g/mol. Its IUPAC name is 1-[1-[3-(4-chloro-3-methylphenoxy)propyl]-7-ethylindol-3-yl]ethanone.
| Compound Name | 1-[1-[3-(4-chloro-3-methylphenoxy)propyl]-7-ethylindol-3-yl]ethanone |
|---|---|
| PubChem CID | 21380867 |
| Molecular Formula | C22H24ClNO2 |
| Molecular Weight | 369.89 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 1-[1-[3-(4-chloro-3-methylphenoxy)propyl]-7-ethylindol-3-yl]ethanone |
| SMILES | CCc1cccc2c(C(C)=O)cn(CCCOc3ccc(Cl)c(C)c3)c12 |
| InChI | InChI=1S/C22H24ClNO2/c1-4-17-7-5-8-19-20(16(3)25)14-24(22(17)19)11-6-12-26-18-9-10-21(23)15(2)13-18/h5,7-10,13-14H,4,6,11-12H2,1-3H3 |
| InChIKey | ZLHHJGRSIJAZQD-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.89 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|