C31H25Cl2N3O4S — CID 21386519
N-[(Z)-3-[4-[2-(2,3-dichloroanilino)-2-oxoethyl]sulfanylanilino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21386519) has the molecular formula C31H25Cl2N3O4S and a molecular weight of 606.53 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(2,3-dichloroanilino)-2-oxoethyl]sulfanylanilino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(2,3-dichloroanilino)-2-oxoethyl]sulfanylanilino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21386519 |
| Molecular Formula | C31H25Cl2N3O4S |
| Molecular Weight | 606.53 g/mol |
| Exact Mass | 605.09 |
| IUPAC Name | N-[(Z)-3-[4-[2-(2,3-dichloroanilino)-2-oxoethyl]sulfanylanilino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SCC(=O)Nc3cccc(Cl)c3Cl)cc2)cc1 |
| InChI | InChI=1S/C31H25Cl2N3O4S/c1-40-23-14-10-20(11-15-23)18-27(36-30(38)21-6-3-2-4-7-21)31(39)34-22-12-16-24(17-13-22)41-19-28(37)35-26-9-5-8-25(32)29(26)33/h2-18H,19H2,1H3,(H,34,39)(H,35,37)(H,36,38)/b27-18- |
| InChIKey | VHBIRIRZPHQNMF-IMRQLAEWSA-N |
| XLogP | 7.14 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.53 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|