About [3-(bromomethyl)phenyl] carbonochloridate
[3-(bromomethyl)phenyl] carbonochloridate (PubChem CID 21386928) has the molecular formula C8H6BrClO2
and a molecular weight of 249.49 g/mol. Its IUPAC name is [3-(bromomethyl)phenyl] carbonochloridate.
Molecular Properties
| Compound Name | [3-(bromomethyl)phenyl] carbonochloridate |
| PubChem CID | 21386928 |
| Molecular Formula | C8H6BrClO2 |
| Molecular Weight | 249.49 g/mol |
| Exact Mass | 247.92 |
| IUPAC Name | [3-(bromomethyl)phenyl] carbonochloridate |
| SMILES | O=C(Cl)Oc1cccc(CBr)c1 |
| InChI | InChI=1S/C8H6BrClO2/c9-5-6-2-1-3-7(4-6)12-8(10)11/h1-4H,5H2 |
| InChIKey | MXQQVAVUAGADSD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [3-(bromomethyl)phenyl] carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(bromomethyl)phenyl] carbonochloridate?
The IUPAC name of [3-(bromomethyl)phenyl] carbonochloridate (CID 21386928) is [3-(bromomethyl)phenyl] carbonochloridate.
What is the SMILES notation for [3-(bromomethyl)phenyl] carbonochloridate?
The canonical SMILES for [3-(bromomethyl)phenyl] carbonochloridate is O=C(Cl)Oc1cccc(CBr)c1.
What is the InChIKey of [3-(bromomethyl)phenyl] carbonochloridate?
The InChIKey is MXQQVAVUAGADSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrClO2/c9-5-6-2-1-3-7(4-6)12-8(10)11/h1-4H,5H2.
What are the key properties of [3-(bromomethyl)phenyl] carbonochloridate?
[3-(bromomethyl)phenyl] carbonochloridate has a molecular weight of 249.49 g/mol, XLogP of 3.32, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(bromomethyl)phenyl] carbonochloridate is sourced from PubChem (CID 21386928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).