C9H12N2O — CID 21388713
1,3-bis(but-3-ynyl)urea (PubChem CID 21388713) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 1,3-bis(but-3-ynyl)urea.
| Compound Name | 1,3-bis(but-3-ynyl)urea |
|---|---|
| PubChem CID | 21388713 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 1,3-bis(but-3-ynyl)urea |
| SMILES | C#CCCNC(=O)NCCC#C |
| InChI | InChI=1S/C9H12N2O/c1-3-5-7-10-9(12)11-8-6-4-2/h1-2H,5-8H2,(H2,10,11,12) |
| InChIKey | ZKJJCUQWHVWOOG-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|