C19H20N6O — CID 21389
1,3-bis[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]urea (PubChem CID 21389) has the molecular formula C19H20N6O and a molecular weight of 348.41 g/mol. Its IUPAC name is 1,3-bis[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]urea.
| Compound Name | 1,3-bis[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 21389 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 1,3-bis[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C2=NCCN2)c1)Nc1cccc(C2=NCCN2)c1 |
| InChI | InChI=1S/C19H20N6O/c26-19(24-15-5-1-3-13(11-15)17-20-7-8-21-17)25-16-6-2-4-14(12-16)18-22-9-10-23-18/h1-6,11-12H,7-10H2,(H,20,21)(H,22,23)(H2,24,25,26) |
| InChIKey | SCEVFJUWLLRELN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |