C24H32N4O5S — CID 21389080
2-ethoxy-N-[2-[2-[(4-methylpiperidin-1-yl)carbamoylsulfamoyl]phenyl]ethyl]benzamide (PubChem CID 21389080) has the molecular formula C24H32N4O5S and a molecular weight of 488.61 g/mol. Its IUPAC name is 2-ethoxy-N-[2-[2-[(4-methylpiperidin-1-yl)carbamoylsulfamoyl]phenyl]ethyl]benzamide.
| Compound Name | 2-ethoxy-N-[2-[2-[(4-methylpiperidin-1-yl)carbamoylsulfamoyl]phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 21389080 |
| Molecular Formula | C24H32N4O5S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 2-ethoxy-N-[2-[2-[(4-methylpiperidin-1-yl)carbamoylsulfamoyl]phenyl]ethyl]benzamide |
| SMILES | CCOc1ccccc1C(=O)NCCc1ccccc1S(=O)(=O)NC(=O)NN1CCC(C)CC1 |
| InChI | InChI=1S/C24H32N4O5S/c1-3-33-21-10-6-5-9-20(21)23(29)25-15-12-19-8-4-7-11-22(19)34(31,32)27-24(30)26-28-16-13-18(2)14-17-28/h4-11,18H,3,12-17H2,1-2H3,(H,25,29)(H2,26,27,30) |
| InChIKey | CCCICELSZIKDGE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |