C13H17N — CID 21390037
5-phenylhepta-1,6-dien-3-amine (PubChem CID 21390037) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 5-phenylhepta-1,6-dien-3-amine.
| Compound Name | 5-phenylhepta-1,6-dien-3-amine |
|---|---|
| PubChem CID | 21390037 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 5-phenylhepta-1,6-dien-3-amine |
| SMILES | C=CC(N)CC(C=C)c1ccccc1 |
| InChI | InChI=1S/C13H17N/c1-3-11(10-13(14)4-2)12-8-6-5-7-9-12/h3-9,11,13H,1-2,10,14H2 |
| InChIKey | FLAHJQOOWNWPJZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|