C11H11F3N4O2 — CID 21390887
ethyl N-amino-N-[4-(trifluoromethyl)-1H-indazol-3-yl]carbamate (PubChem CID 21390887) has the molecular formula C11H11F3N4O2 and a molecular weight of 288.23 g/mol. Its IUPAC name is ethyl N-amino-N-[4-(trifluoromethyl)-1H-indazol-3-yl]carbamate.
| Compound Name | ethyl N-amino-N-[4-(trifluoromethyl)-1H-indazol-3-yl]carbamate |
|---|---|
| PubChem CID | 21390887 |
| Molecular Formula | C11H11F3N4O2 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | ethyl N-amino-N-[4-(trifluoromethyl)-1H-indazol-3-yl]carbamate |
| SMILES | CCOC(=O)N(N)c1n[nH]c2cccc(C(F)(F)F)c12 |
| InChI | InChI=1S/C11H11F3N4O2/c1-2-20-10(19)18(15)9-8-6(11(12,13)14)4-3-5-7(8)16-17-9/h3-5H,2,15H2,1H3,(H,16,17) |
| InChIKey | GWFGGUFWDBGKCH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|