About bis(dicyclohexyl-sulfanylidene-sulfido-λ5-phosphane);ethenylsulfanylethene
bis(dicyclohexyl-sulfanylidene-sulfido-λ5-phosphane);ethenylsulfanylethene (PubChem CID 21391618) has the molecular formula C28H50P2S5-2
and a molecular weight of 608.99 g/mol. Its IUPAC name is bis(dicyclohexyl-sulfanylidene-sulfido-λ5-phosphane);ethenylsulfanylethene.
Molecular Properties
| Compound Name | bis(dicyclohexyl-sulfanylidene-sulfido-λ5-phosphane);ethenylsulfanylethene |
| PubChem CID | 21391618 |
| Molecular Formula | C28H50P2S5-2 |
| Molecular Weight | 608.99 g/mol |
| Exact Mass | 608.20 |
| IUPAC Name | bis(dicyclohexyl-sulfanylidene-sulfido-λ5-phosphane);ethenylsulfanylethene |
| SMILES | C=CSC=C.S=P([S-])(C1CCCCC1)C1CCCCC1.S=P([S-])(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/2C12H23PS2.C4H6S/c2*14-13(15,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-3-5-4-2/h2*11-12H,1-10H2,(H,14,15);3-4H,1-2H2/p-2 |
| InChIKey | UFGZAHICRWNXMH-UHFFFAOYSA-L |
| XLogP | 11.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 608.99 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze bis(dicyclohexyl-sulfanylidene-sulfido-λ5-phosphane);ethenylsulfanylethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(dicyclohexyl-sulfanylidene-sulfido-λ5-phosphane);ethenylsulfanylethene?
The IUPAC name of bis(dicyclohexyl-sulfanylidene-sulfido-λ5-phosphane);ethenylsulfanylethene (CID 21391618) is bis(dicyclohexyl-sulfanylidene-sulfido-λ5-phosphane);ethenylsulfanylethene.
What is the SMILES notation for bis(dicyclohexyl-sulfanylidene-sulfido-λ5-phosphane);ethenylsulfanylethene?
The canonical SMILES for bis(dicyclohexyl-sulfanylidene-sulfido-λ5-phosphane);ethenylsulfanylethene is C=CSC=C.S=P([S-])(C1CCCCC1)C1CCCCC1.S=P([S-])(C1CCCCC1)C1CCCCC1.
What is the InChIKey of bis(dicyclohexyl-sulfanylidene-sulfido-λ5-phosphane);ethenylsulfanylethene?
The InChIKey is UFGZAHICRWNXMH-UHFFFAOYSA-L. The full InChI is InChI=1S/2C12H23PS2.C4H6S/c2*14-13(15,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-3-5-4-2/h2*11-12H,1-10H2,(H,14,15);3-4H,1-2H2/p-2.
What are the key properties of bis(dicyclohexyl-sulfanylidene-sulfido-λ5-phosphane);ethenylsulfanylethene?
bis(dicyclohexyl-sulfanylidene-sulfido-λ5-phosphane);ethenylsulfanylethene has a molecular weight of 608.99 g/mol, XLogP of 11.19, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(dicyclohexyl-sulfanylidene-sulfido-λ5-phosphane);ethenylsulfanylethene is sourced from PubChem (CID 21391618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).