C28H53NP2S2 — CID 88546870
[cycloheptyl-[di(cycloheptyl)phosphinothioylamino]phosphinothioyl]cycloheptane (PubChem CID 88546870) has the molecular formula C28H53NP2S2 and a molecular weight of 529.82 g/mol. Its IUPAC name is [cycloheptyl-[di(cycloheptyl)phosphinothioylamino]phosphinothioyl]cycloheptane.
| Compound Name | [cycloheptyl-[di(cycloheptyl)phosphinothioylamino]phosphinothioyl]cycloheptane |
|---|---|
| PubChem CID | 88546870 |
| Molecular Formula | C28H53NP2S2 |
| Molecular Weight | 529.82 g/mol |
| Exact Mass | 529.31 |
| IUPAC Name | [cycloheptyl-[di(cycloheptyl)phosphinothioylamino]phosphinothioyl]cycloheptane |
| SMILES | S=P(NP(=S)(C1CCCCCC1)C1CCCCCC1)(C1CCCCCC1)C1CCCCCC1 |
| InChI | InChI=1S/C28H53NP2S2/c32-30(25-17-9-1-2-10-18-25,26-19-11-3-4-12-20-26)29-31(33,27-21-13-5-6-14-22-27)28-23-15-7-8-16-24-28/h25-28H,1-24H2,(H,29,32,33) |
| InChIKey | NRFSQSMTVCVUCY-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.82 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|