C21H26FNO2 — CID 21396134
1-[4-(4-fluorophenyl)phenoxy]-2-methyl-3-piperidin-1-ylpropan-2-ol (PubChem CID 21396134) has the molecular formula C21H26FNO2 and a molecular weight of 343.44 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)phenoxy]-2-methyl-3-piperidin-1-ylpropan-2-ol.
| Compound Name | 1-[4-(4-fluorophenyl)phenoxy]-2-methyl-3-piperidin-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 21396134 |
| Molecular Formula | C21H26FNO2 |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 1-[4-(4-fluorophenyl)phenoxy]-2-methyl-3-piperidin-1-ylpropan-2-ol |
| SMILES | CC(O)(COc1ccc(-c2ccc(F)cc2)cc1)CN1CCCCC1 |
| InChI | InChI=1S/C21H26FNO2/c1-21(24,15-23-13-3-2-4-14-23)16-25-20-11-7-18(8-12-20)17-5-9-19(22)10-6-17/h5-12,24H,2-4,13-16H2,1H3 |
| InChIKey | JUOOVDLQRHIGGV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |