C13H20O3 — CID 21397293
2-octan-3-ylpyran-3,4-dione (PubChem CID 21397293) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-octan-3-ylpyran-3,4-dione.
| Compound Name | 2-octan-3-ylpyran-3,4-dione |
|---|---|
| PubChem CID | 21397293 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 2-octan-3-ylpyran-3,4-dione |
| SMILES | CCCCCC(CC)C1OC=CC(=O)C1=O |
| InChI | InChI=1S/C13H20O3/c1-3-5-6-7-10(4-2)13-12(15)11(14)8-9-16-13/h8-10,13H,3-7H2,1-2H3 |
| InChIKey | CCPUIJMQHNUWCX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|