C28H52O8S4Sn — CID 21398702
bis(4-(2-butoxyethoxy)-3-hydroxy-4-sulfanylidenebutanethioate);dibutyltin(2+) (PubChem CID 21398702) has the molecular formula C28H52O8S4Sn and a molecular weight of 763.69 g/mol. Its IUPAC name is bis(4-(2-butoxyethoxy)-3-hydroxy-4-sulfanylidenebutanethioate);dibutyltin(2+).
| Compound Name | bis(4-(2-butoxyethoxy)-3-hydroxy-4-sulfanylidenebutanethioate);dibutyltin(2+) |
|---|---|
| PubChem CID | 21398702 |
| Molecular Formula | C28H52O8S4Sn |
| Molecular Weight | 763.69 g/mol |
| Exact Mass | 764.16 |
| IUPAC Name | bis(4-(2-butoxyethoxy)-3-hydroxy-4-sulfanylidenebutanethioate);dibutyltin(2+) |
| SMILES | CCCCOCCOC(=S)C(O)CC(=O)[S-].CCCCOCCOC(=S)C(O)CC(=O)[S-].CCCC[Sn+2]CCCC |
| InChI | InChI=1S/2C10H18O4S2.2C4H9.Sn/c2*1-2-3-4-13-5-6-14-10(16)8(11)7-9(12)15;2*1-3-4-2;/h2*8,11H,2-7H2,1H3,(H,12,15);2*1,3-4H2,2H3;/q;;;;+2/p-2 |
| InChIKey | XSHCPAGWNOUCEH-UHFFFAOYSA-L |
| XLogP | 5.07 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.69 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|