About 1-chloro-5-methoxy-2,6-dimethylheptane
1-chloro-5-methoxy-2,6-dimethylheptane (PubChem CID 21399083) has the molecular formula C10H21ClO
and a molecular weight of 192.73 g/mol. Its IUPAC name is 1-chloro-5-methoxy-2,6-dimethylheptane.
Molecular Properties
| Compound Name | 1-chloro-5-methoxy-2,6-dimethylheptane |
| PubChem CID | 21399083 |
| Molecular Formula | C10H21ClO |
| Molecular Weight | 192.73 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 1-chloro-5-methoxy-2,6-dimethylheptane |
| SMILES | COC(CCC(C)CCl)C(C)C |
| InChI | InChI=1S/C10H21ClO/c1-8(2)10(12-4)6-5-9(3)7-11/h8-10H,5-7H2,1-4H3 |
| InChIKey | XNBYZTVQVHSWMB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.73 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-5-methoxy-2,6-dimethylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-5-methoxy-2,6-dimethylheptane?
The IUPAC name of 1-chloro-5-methoxy-2,6-dimethylheptane (CID 21399083) is 1-chloro-5-methoxy-2,6-dimethylheptane.
What is the SMILES notation for 1-chloro-5-methoxy-2,6-dimethylheptane?
The canonical SMILES for 1-chloro-5-methoxy-2,6-dimethylheptane is COC(CCC(C)CCl)C(C)C.
What is the InChIKey of 1-chloro-5-methoxy-2,6-dimethylheptane?
The InChIKey is XNBYZTVQVHSWMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21ClO/c1-8(2)10(12-4)6-5-9(3)7-11/h8-10H,5-7H2,1-4H3.
What are the key properties of 1-chloro-5-methoxy-2,6-dimethylheptane?
1-chloro-5-methoxy-2,6-dimethylheptane has a molecular weight of 192.73 g/mol, XLogP of 3.31, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-5-methoxy-2,6-dimethylheptane is sourced from PubChem (CID 21399083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).