C13H19NO5 — CID 21402119
(2,4,5-triethyl-3-nitrophenyl)methanetriol (PubChem CID 21402119) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is (2,4,5-triethyl-3-nitrophenyl)methanetriol.
| Compound Name | (2,4,5-triethyl-3-nitrophenyl)methanetriol |
|---|---|
| PubChem CID | 21402119 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | (2,4,5-triethyl-3-nitrophenyl)methanetriol |
| SMILES | CCc1cc(C(O)(O)O)c(CC)c([N+](=O)[O-])c1CC |
| InChI | InChI=1S/C13H19NO5/c1-4-8-7-11(13(15,16)17)10(6-3)12(14(18)19)9(8)5-2/h7,15-17H,4-6H2,1-3H3 |
| InChIKey | RCBQERUFVSVSTF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|