About diethoxyarsinous acid
diethoxyarsinous acid (PubChem CID 21402593) has the molecular formula C4H11AsO3
and a molecular weight of 182.05 g/mol. Its IUPAC name is diethoxyarsinous acid.
Molecular Properties
| Compound Name | diethoxyarsinous acid |
| PubChem CID | 21402593 |
| Molecular Formula | C4H11AsO3 |
| Molecular Weight | 182.05 g/mol |
| Exact Mass | 181.99 |
| IUPAC Name | diethoxyarsinous acid |
| SMILES | CCO[As](O)OCC |
| InChI | InChI=1S/C4H11AsO3/c1-3-7-5(6)8-4-2/h6H,3-4H2,1-2H3 |
| InChIKey | CHWVHOVMYJNPSL-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.05 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diethoxyarsinous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxyarsinous acid?
The IUPAC name of diethoxyarsinous acid (CID 21402593) is diethoxyarsinous acid.
What is the SMILES notation for diethoxyarsinous acid?
The canonical SMILES for diethoxyarsinous acid is CCO[As](O)OCC.
What is the InChIKey of diethoxyarsinous acid?
The InChIKey is CHWVHOVMYJNPSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11AsO3/c1-3-7-5(6)8-4-2/h6H,3-4H2,1-2H3.
What are the key properties of diethoxyarsinous acid?
diethoxyarsinous acid has a molecular weight of 182.05 g/mol, XLogP of 0.04, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxyarsinous acid is sourced from PubChem (CID 21402593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).