About ethoxyarsonous acid
ethoxyarsonous acid (PubChem CID 87980186) has the molecular formula C2H7AsO3
and a molecular weight of 154.00 g/mol. Its IUPAC name is ethoxyarsonous acid.
Molecular Properties
| Compound Name | ethoxyarsonous acid |
| PubChem CID | 87980186 |
| Molecular Formula | C2H7AsO3 |
| Molecular Weight | 154.00 g/mol |
| Exact Mass | 153.96 |
| IUPAC Name | ethoxyarsonous acid |
| SMILES | CCO[As](O)O |
| InChI | InChI=1S/C2H7AsO3/c1-2-6-3(4)5/h4-5H,2H2,1H3 |
| InChIKey | NDBMKSCOCQGEEX-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.00 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethoxyarsonous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyarsonous acid?
The IUPAC name of ethoxyarsonous acid (CID 87980186) is ethoxyarsonous acid.
What is the SMILES notation for ethoxyarsonous acid?
The canonical SMILES for ethoxyarsonous acid is CCO[As](O)O.
What is the InChIKey of ethoxyarsonous acid?
The InChIKey is NDBMKSCOCQGEEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7AsO3/c1-2-6-3(4)5/h4-5H,2H2,1H3.
What are the key properties of ethoxyarsonous acid?
ethoxyarsonous acid has a molecular weight of 154.00 g/mol, XLogP of -1.01, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyarsonous acid is sourced from PubChem (CID 87980186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).