About piperidine;piperidine-1-carboxamide
piperidine;piperidine-1-carboxamide (PubChem CID 21403192) has the molecular formula C11H23N3O
and a molecular weight of 213.32 g/mol. Its IUPAC name is piperidine;piperidine-1-carboxamide.
Molecular Properties
| Compound Name | piperidine;piperidine-1-carboxamide |
| PubChem CID | 21403192 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | piperidine;piperidine-1-carboxamide |
| SMILES | C1CCNCC1.NC(=O)N1CCCCC1 |
| InChI | InChI=1S/C6H12N2O.C5H11N/c7-6(9)8-4-2-1-3-5-8;1-2-4-6-5-3-1/h1-5H2,(H2,7,9);6H,1-5H2 |
| InChIKey | VXICYCFKLUFDPR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze piperidine;piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine;piperidine-1-carboxamide?
The IUPAC name of piperidine;piperidine-1-carboxamide (CID 21403192) is piperidine;piperidine-1-carboxamide.
What is the SMILES notation for piperidine;piperidine-1-carboxamide?
The canonical SMILES for piperidine;piperidine-1-carboxamide is C1CCNCC1.NC(=O)N1CCCCC1.
What is the InChIKey of piperidine;piperidine-1-carboxamide?
The InChIKey is VXICYCFKLUFDPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.C5H11N/c7-6(9)8-4-2-1-3-5-8;1-2-4-6-5-3-1/h1-5H2,(H2,7,9);6H,1-5H2.
What are the key properties of piperidine;piperidine-1-carboxamide?
piperidine;piperidine-1-carboxamide has a molecular weight of 213.32 g/mol, XLogP of 1.31, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine;piperidine-1-carboxamide is sourced from PubChem (CID 21403192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).