C23H29N3O4S — CID 21404633
3-[2-(4-nitrophenyl)ethyl]-2-[2-[3-(propan-2-ylamino)propoxy]phenyl]-1,3-thiazolidin-4-one (PubChem CID 21404633) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is 3-[2-(4-nitrophenyl)ethyl]-2-[2-[3-(propan-2-ylamino)propoxy]phenyl]-1,3-thiazolidin-4-one.
| Compound Name | 3-[2-(4-nitrophenyl)ethyl]-2-[2-[3-(propan-2-ylamino)propoxy]phenyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 21404633 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 3-[2-(4-nitrophenyl)ethyl]-2-[2-[3-(propan-2-ylamino)propoxy]phenyl]-1,3-thiazolidin-4-one |
| SMILES | CC(C)NCCCOc1ccccc1C1SCC(=O)N1CCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H29N3O4S/c1-17(2)24-13-5-15-30-21-7-4-3-6-20(21)23-25(22(27)16-31-23)14-12-18-8-10-19(11-9-18)26(28)29/h3-4,6-11,17,23-24H,5,12-16H2,1-2H3 |
| InChIKey | MFXWJWHUBTVCDX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|