C22H32N6O2 — CID 21404665
N-butyl-N-[3-[2-(1-methyl-5-nitroimidazol-2-yl)benzimidazol-1-yl]propyl]butan-1-amine (PubChem CID 21404665) has the molecular formula C22H32N6O2 and a molecular weight of 412.54 g/mol. Its IUPAC name is N-butyl-N-[3-[2-(1-methyl-5-nitroimidazol-2-yl)benzimidazol-1-yl]propyl]butan-1-amine.
| Compound Name | N-butyl-N-[3-[2-(1-methyl-5-nitroimidazol-2-yl)benzimidazol-1-yl]propyl]butan-1-amine |
|---|---|
| PubChem CID | 21404665 |
| Molecular Formula | C22H32N6O2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | N-butyl-N-[3-[2-(1-methyl-5-nitroimidazol-2-yl)benzimidazol-1-yl]propyl]butan-1-amine |
| SMILES | CCCCN(CCCC)CCCn1c(-c2ncc([N+](=O)[O-])n2C)nc2ccccc21 |
| InChI | InChI=1S/C22H32N6O2/c1-4-6-13-26(14-7-5-2)15-10-16-27-19-12-9-8-11-18(19)24-22(27)21-23-17-20(25(21)3)28(29)30/h8-9,11-12,17H,4-7,10,13-16H2,1-3H3 |
| InChIKey | SIYLVOANDBQNPS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 82.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|