C23H22N2O5 — CID 21406015
2-[4-hydroxy-3-(morpholine-4-carbonyl)naphthalen-1-yl]oxy-N-phenylacetamide (PubChem CID 21406015) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is 2-[4-hydroxy-3-(morpholine-4-carbonyl)naphthalen-1-yl]oxy-N-phenylacetamide.
| Compound Name | 2-[4-hydroxy-3-(morpholine-4-carbonyl)naphthalen-1-yl]oxy-N-phenylacetamide |
|---|---|
| PubChem CID | 21406015 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-[4-hydroxy-3-(morpholine-4-carbonyl)naphthalen-1-yl]oxy-N-phenylacetamide |
| SMILES | O=C(COc1cc(C(=O)N2CCOCC2)c(O)c2ccccc12)Nc1ccccc1 |
| InChI | InChI=1S/C23H22N2O5/c26-21(24-16-6-2-1-3-7-16)15-30-20-14-19(23(28)25-10-12-29-13-11-25)22(27)18-9-5-4-8-17(18)20/h1-9,14,27H,10-13,15H2,(H,24,26) |
| InChIKey | CCWKOPRZGYUPGP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |