3-ethyl-1-methyl-2,4-dioxopyrimidine-5-carboxylic acid

C8H10N2O4 — CID 21406695

IUPAC3-ethyl-1-methyl-2,4-dioxopyrimidine-5-carboxylic acid
SMILESCCn1c(=O)c(C(=O)O)cn(C)c1=O
InChIInChI=1S/C8H10N2O4/c1-3-10-6(11)5(7(12)13)4-9(2)8(10)14/h4H,3H2,1-2H3,(H,12,13)
InChIKeyFFBARFRROKIYBZ-UHFFFAOYSA-N
MW198.18 g/mol
LogP-0.73
Rot. Bonds2

About 3-ethyl-1-methyl-2,4-dioxopyrimidine-5-carboxylic acid

3-ethyl-1-methyl-2,4-dioxopyrimidine-5-carboxylic acid (PubChem CID 21406695) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is 3-ethyl-1-methyl-2,4-dioxopyrimidine-5-carboxylic acid.

Molecular Properties

Compound Name3-ethyl-1-methyl-2,4-dioxopyrimidine-5-carboxylic acid
PubChem CID21406695
Molecular FormulaC8H10N2O4
Molecular Weight198.18 g/mol
Exact Mass198.06
IUPAC Name3-ethyl-1-methyl-2,4-dioxopyrimidine-5-carboxylic acid
SMILESCCn1c(=O)c(C(=O)O)cn(C)c1=O
InChIInChI=1S/C8H10N2O4/c1-3-10-6(11)5(7(12)13)4-9(2)8(10)14/h4H,3H2,1-2H3,(H,12,13)
InChIKeyFFBARFRROKIYBZ-UHFFFAOYSA-N
XLogP-0.73
TPSA81.30 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.18
LogP ≤ 5-0.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 3-ethyl-1-methyl-2,4-dioxopyrimidine-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-ethyl-1-methyl-2,4-dioxopyrimidine-5-carboxylic acid?
The IUPAC name of 3-ethyl-1-methyl-2,4-dioxopyrimidine-5-carboxylic acid (CID 21406695) is 3-ethyl-1-methyl-2,4-dioxopyrimidine-5-carboxylic acid.
What is the SMILES notation for 3-ethyl-1-methyl-2,4-dioxopyrimidine-5-carboxylic acid?
The canonical SMILES for 3-ethyl-1-methyl-2,4-dioxopyrimidine-5-carboxylic acid is CCn1c(=O)c(C(=O)O)cn(C)c1=O.
What is the InChIKey of 3-ethyl-1-methyl-2,4-dioxopyrimidine-5-carboxylic acid?
The InChIKey is FFBARFRROKIYBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O4/c1-3-10-6(11)5(7(12)13)4-9(2)8(10)14/h4H,3H2,1-2H3,(H,12,13).
What are the key properties of 3-ethyl-1-methyl-2,4-dioxopyrimidine-5-carboxylic acid?
3-ethyl-1-methyl-2,4-dioxopyrimidine-5-carboxylic acid has a molecular weight of 198.18 g/mol, XLogP of -0.73, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-methyl-2,4-dioxopyrimidine-5-carboxylic acid is sourced from PubChem (CID 21406695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).