About 3-azidopropanethioyl chloride
3-azidopropanethioyl chloride (PubChem CID 21407749) has the molecular formula C3H4ClN3S
and a molecular weight of 149.61 g/mol. Its IUPAC name is 3-azidopropanethioyl chloride.
Molecular Properties
| Compound Name | 3-azidopropanethioyl chloride |
| PubChem CID | 21407749 |
| Molecular Formula | C3H4ClN3S |
| Molecular Weight | 149.61 g/mol |
| Exact Mass | 148.98 |
| IUPAC Name | 3-azidopropanethioyl chloride |
| SMILES | [N-]=[N+]=NCCC(=S)Cl |
| InChI | InChI=1S/C3H4ClN3S/c4-3(8)1-2-6-7-5/h1-2H2 |
| InChIKey | PXZBZFOKCFDZLI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.61 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-azidopropanethioyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azidopropanethioyl chloride?
The IUPAC name of 3-azidopropanethioyl chloride (CID 21407749) is 3-azidopropanethioyl chloride.
What is the SMILES notation for 3-azidopropanethioyl chloride?
The canonical SMILES for 3-azidopropanethioyl chloride is [N-]=[N+]=NCCC(=S)Cl.
What is the InChIKey of 3-azidopropanethioyl chloride?
The InChIKey is PXZBZFOKCFDZLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4ClN3S/c4-3(8)1-2-6-7-5/h1-2H2.
What are the key properties of 3-azidopropanethioyl chloride?
3-azidopropanethioyl chloride has a molecular weight of 149.61 g/mol, XLogP of 2.25, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azidopropanethioyl chloride is sourced from PubChem (CID 21407749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).