C23H23Cl2NO3S — CID 21408285
2-[[4,5-bis(4-chlorophenyl)-1,3-oxazol-2-yl]sulfanyl]octanoic acid (PubChem CID 21408285) has the molecular formula C23H23Cl2NO3S and a molecular weight of 464.41 g/mol. Its IUPAC name is 2-[[4,5-bis(4-chlorophenyl)-1,3-oxazol-2-yl]sulfanyl]octanoic acid.
| Compound Name | 2-[[4,5-bis(4-chlorophenyl)-1,3-oxazol-2-yl]sulfanyl]octanoic acid |
|---|---|
| PubChem CID | 21408285 |
| Molecular Formula | C23H23Cl2NO3S |
| Molecular Weight | 464.41 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | 2-[[4,5-bis(4-chlorophenyl)-1,3-oxazol-2-yl]sulfanyl]octanoic acid |
| SMILES | CCCCCCC(Sc1nc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)o1)C(=O)O |
| InChI | InChI=1S/C23H23Cl2NO3S/c1-2-3-4-5-6-19(22(27)28)30-23-26-20(15-7-11-17(24)12-8-15)21(29-23)16-9-13-18(25)14-10-16/h7-14,19H,2-6H2,1H3,(H,27,28) |
| InChIKey | UUVXFZUWOQACFF-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.41 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|