About [4-(benzenesulfonamido)-3,5-dimethoxyphenyl] N-methylcarbamate
[4-(benzenesulfonamido)-3,5-dimethoxyphenyl] N-methylcarbamate (PubChem CID 21409256) has the molecular formula C16H18N2O6S
and a molecular weight of 366.40 g/mol. Its IUPAC name is [4-(benzenesulfonamido)-3,5-dimethoxyphenyl] N-methylcarbamate.
Molecular Properties
| Compound Name | [4-(benzenesulfonamido)-3,5-dimethoxyphenyl] N-methylcarbamate |
| PubChem CID | 21409256 |
| Molecular Formula | C16H18N2O6S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | [4-(benzenesulfonamido)-3,5-dimethoxyphenyl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1cc(OC)c(NS(=O)(=O)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C16H18N2O6S/c1-17-16(19)24-11-9-13(22-2)15(14(10-11)23-3)18-25(20,21)12-7-5-4-6-8-12/h4-10,18H,1-3H3,(H,17,19) |
| InChIKey | QVMBRXGYGXKUHL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-(benzenesulfonamido)-3,5-dimethoxyphenyl] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(benzenesulfonamido)-3,5-dimethoxyphenyl] N-methylcarbamate?
The IUPAC name of [4-(benzenesulfonamido)-3,5-dimethoxyphenyl] N-methylcarbamate (CID 21409256) is [4-(benzenesulfonamido)-3,5-dimethoxyphenyl] N-methylcarbamate.
What is the SMILES notation for [4-(benzenesulfonamido)-3,5-dimethoxyphenyl] N-methylcarbamate?
The canonical SMILES for [4-(benzenesulfonamido)-3,5-dimethoxyphenyl] N-methylcarbamate is CNC(=O)Oc1cc(OC)c(NS(=O)(=O)c2ccccc2)c(OC)c1.
What is the InChIKey of [4-(benzenesulfonamido)-3,5-dimethoxyphenyl] N-methylcarbamate?
The InChIKey is QVMBRXGYGXKUHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O6S/c1-17-16(19)24-11-9-13(22-2)15(14(10-11)23-3)18-25(20,21)12-7-5-4-6-8-12/h4-10,18H,1-3H3,(H,17,19).
What are the key properties of [4-(benzenesulfonamido)-3,5-dimethoxyphenyl] N-methylcarbamate?
[4-(benzenesulfonamido)-3,5-dimethoxyphenyl] N-methylcarbamate has a molecular weight of 366.40 g/mol, XLogP of 2.22, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(benzenesulfonamido)-3,5-dimethoxyphenyl] N-methylcarbamate is sourced from PubChem (CID 21409256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).