C20H27BrF6NO2- — CID 21409997
2,2,3,4,4,4-hexafluorobutyl 11-pyridin-2-ylundecanoate bromide (PubChem CID 21409997) has the molecular formula C20H27BrF6NO2- and a molecular weight of 507.33 g/mol. Its IUPAC name is 2,2,3,4,4,4-hexafluorobutyl 11-pyridin-2-ylundecanoate bromide.
| Compound Name | 2,2,3,4,4,4-hexafluorobutyl 11-pyridin-2-ylundecanoate bromide |
|---|---|
| PubChem CID | 21409997 |
| Molecular Formula | C20H27BrF6NO2- |
| Molecular Weight | 507.33 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | 2,2,3,4,4,4-hexafluorobutyl 11-pyridin-2-ylundecanoate bromide |
| SMILES | O=C(CCCCCCCCCCc1ccccn1)OCC(F)(F)C(F)C(F)(F)F.[Br-] |
| InChI | InChI=1S/C20H27F6NO2.BrH/c21-18(20(24,25)26)19(22,23)15-29-17(28)13-8-6-4-2-1-3-5-7-11-16-12-9-10-14-27-16;/h9-10,12,14,18H,1-8,11,13,15H2;1H/p-1 |
| InChIKey | WGRBCDULMXUINA-UHFFFAOYSA-M |
| XLogP | 3.22 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|