C15H11ClF3NO3 — CID 21411978
2-[3-chloro-1-methyl-5-[4-(trifluoromethyl)benzoyl]pyrrol-2-yl]acetic acid (PubChem CID 21411978) has the molecular formula C15H11ClF3NO3 and a molecular weight of 345.70 g/mol. Its IUPAC name is 2-[3-chloro-1-methyl-5-[4-(trifluoromethyl)benzoyl]pyrrol-2-yl]acetic acid.
| Compound Name | 2-[3-chloro-1-methyl-5-[4-(trifluoromethyl)benzoyl]pyrrol-2-yl]acetic acid |
|---|---|
| PubChem CID | 21411978 |
| Molecular Formula | C15H11ClF3NO3 |
| Molecular Weight | 345.70 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 2-[3-chloro-1-methyl-5-[4-(trifluoromethyl)benzoyl]pyrrol-2-yl]acetic acid |
| SMILES | Cn1c(C(=O)c2ccc(C(F)(F)F)cc2)cc(Cl)c1CC(=O)O |
| InChI | InChI=1S/C15H11ClF3NO3/c1-20-11(7-13(21)22)10(16)6-12(20)14(23)8-2-4-9(5-3-8)15(17,18)19/h2-6H,7H2,1H3,(H,21,22) |
| InChIKey | GWTQTYBANFHANF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.70 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |