C33H67N — CID 21412162
8,8,10,10-tetrabutylheptadecan-9-imine (PubChem CID 21412162) has the molecular formula C33H67N and a molecular weight of 477.91 g/mol. Its IUPAC name is 8,8,10,10-tetrabutylheptadecan-9-imine.
| Compound Name | 8,8,10,10-tetrabutylheptadecan-9-imine |
|---|---|
| PubChem CID | 21412162 |
| Molecular Formula | C33H67N |
| Molecular Weight | 477.91 g/mol |
| Exact Mass | 477.53 |
| IUPAC Name | 8,8,10,10-tetrabutylheptadecan-9-imine |
| SMILES | [H]N=C(C(CCCC)(CCCC)CCCCCCC)C(CCCC)(CCCC)CCCCCCC |
| InChI | InChI=1S/C33H67N/c1-7-13-19-21-23-29-32(25-15-9-3,26-16-10-4)31(34)33(27-17-11-5,28-18-12-6)30-24-22-20-14-8-2/h34H,7-30H2,1-6H3 |
| InChIKey | SWWQFYJXYXLQJR-UHFFFAOYSA-N |
| XLogP | 12.46 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.91 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|