C18H30N2O6P2 — CID 21415815
diazanium;6-[oxido(phenyl)phosphoryl]oxyhexoxy-phenylphosphinate (PubChem CID 21415815) has the molecular formula C18H30N2O6P2 and a molecular weight of 432.39 g/mol. Its IUPAC name is diazanium;6-[oxido(phenyl)phosphoryl]oxyhexoxy-phenylphosphinate.
| Compound Name | diazanium;6-[oxido(phenyl)phosphoryl]oxyhexoxy-phenylphosphinate |
|---|---|
| PubChem CID | 21415815 |
| Molecular Formula | C18H30N2O6P2 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | diazanium;6-[oxido(phenyl)phosphoryl]oxyhexoxy-phenylphosphinate |
| SMILES | O=P([O-])(OCCCCCCOP(=O)([O-])c1ccccc1)c1ccccc1.[NH4+].[NH4+] |
| InChI | InChI=1S/C18H24O6P2.2H3N/c19-25(20,17-11-5-3-6-12-17)23-15-9-1-2-10-16-24-26(21,22)18-13-7-4-8-14-18;;/h3-8,11-14H,1-2,9-10,15-16H2,(H,19,20)(H,21,22);2*1H3 |
| InChIKey | ZFPGDJUBQBGCEN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 171.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|