C15H12O — CID 21417039
(1E)-1-naphthalen-1-ylpenta-1,4-dien-3-one (PubChem CID 21417039) has the molecular formula C15H12O and a molecular weight of 208.26 g/mol. Its IUPAC name is (1E)-1-naphthalen-1-ylpenta-1,4-dien-3-one.
| Compound Name | (1E)-1-naphthalen-1-ylpenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 21417039 |
| Molecular Formula | C15H12O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | (1E)-1-naphthalen-1-ylpenta-1,4-dien-3-one |
| SMILES | C=CC(=O)/C=C/c1cccc2ccccc12 |
| InChI | InChI=1S/C15H12O/c1-2-14(16)11-10-13-8-5-7-12-6-3-4-9-15(12)13/h2-11H,1H2/b11-10+ |
| InChIKey | CAOSVPJVXYGNKL-ZHACJKMWSA-N |
| XLogP | 3.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|