C25H16Br2O — CID 176830336
(1E,4E)-1,5-bis(7-bromonaphthalen-1-yl)penta-1,4-dien-3-one (PubChem CID 176830336) has the molecular formula C25H16Br2O and a molecular weight of 492.21 g/mol. Its IUPAC name is (1E,4E)-1,5-bis(7-bromonaphthalen-1-yl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1,5-bis(7-bromonaphthalen-1-yl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 176830336 |
| Molecular Formula | C25H16Br2O |
| Molecular Weight | 492.21 g/mol |
| Exact Mass | 489.96 |
| IUPAC Name | (1E,4E)-1,5-bis(7-bromonaphthalen-1-yl)penta-1,4-dien-3-one |
| SMILES | O=C(/C=C/c1cccc2ccc(Br)cc12)/C=C/c1cccc2ccc(Br)cc12 |
| InChI | InChI=1S/C25H16Br2O/c26-21-11-7-17-3-1-5-19(24(17)15-21)9-13-23(28)14-10-20-6-2-4-18-8-12-22(27)16-25(18)20/h1-16H/b13-9+,14-10+ |
| InChIKey | GBRZWIWVWJOOLO-UTLPMFLDSA-N |
| XLogP | 7.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.21 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|