C21H16N2O — CID 176830385
(1E,4E)-1,5-bis(1H-indol-4-yl)penta-1,4-dien-3-one (PubChem CID 176830385) has the molecular formula C21H16N2O and a molecular weight of 312.37 g/mol. Its IUPAC name is (1E,4E)-1,5-bis(1H-indol-4-yl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1,5-bis(1H-indol-4-yl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 176830385 |
| Molecular Formula | C21H16N2O |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (1E,4E)-1,5-bis(1H-indol-4-yl)penta-1,4-dien-3-one |
| SMILES | O=C(/C=C/c1cccc2[nH]ccc12)/C=C/c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C21H16N2O/c24-17(9-7-15-3-1-5-20-18(15)11-13-22-20)10-8-16-4-2-6-21-19(16)12-14-23-21/h1-14,22-23H/b9-7+,10-8+ |
| InChIKey | YZGIFFQTVYATFK-FIFLTTCUSA-N |
| XLogP | 4.94 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|