About 4-prop-1-enyl-1H-indole
4-prop-1-enyl-1H-indole (PubChem CID 77378608) has the molecular formula C11H11N
and a molecular weight of 157.22 g/mol. Its IUPAC name is 4-prop-1-enyl-1H-indole.
Molecular Properties
| Compound Name | 4-prop-1-enyl-1H-indole |
| PubChem CID | 77378608 |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 4-prop-1-enyl-1H-indole |
| SMILES | CC=Cc1cccc2[nH]ccc12 |
| InChI | InChI=1S/C11H11N/c1-2-4-9-5-3-6-11-10(9)7-8-12-11/h2-8,12H,1H3 |
| InChIKey | OPCNVMQEMTUIFB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-prop-1-enyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-prop-1-enyl-1H-indole?
The IUPAC name of 4-prop-1-enyl-1H-indole (CID 77378608) is 4-prop-1-enyl-1H-indole.
What is the SMILES notation for 4-prop-1-enyl-1H-indole?
The canonical SMILES for 4-prop-1-enyl-1H-indole is CC=Cc1cccc2[nH]ccc12.
What is the InChIKey of 4-prop-1-enyl-1H-indole?
The InChIKey is OPCNVMQEMTUIFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N/c1-2-4-9-5-3-6-11-10(9)7-8-12-11/h2-8,12H,1H3.
What are the key properties of 4-prop-1-enyl-1H-indole?
4-prop-1-enyl-1H-indole has a molecular weight of 157.22 g/mol, XLogP of 3.20, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-prop-1-enyl-1H-indole is sourced from PubChem (CID 77378608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).