C13H13N — CID 132505356
4-[(1E)-3-methylbuta-1,3-dienyl]-1H-indole (PubChem CID 132505356) has the molecular formula C13H13N and a molecular weight of 183.25 g/mol. Its IUPAC name is 4-[(1E)-3-methylbuta-1,3-dienyl]-1H-indole.
| Compound Name | 4-[(1E)-3-methylbuta-1,3-dienyl]-1H-indole |
|---|---|
| PubChem CID | 132505356 |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 4-[(1E)-3-methylbuta-1,3-dienyl]-1H-indole |
| SMILES | C=C(C)/C=C/c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C13H13N/c1-10(2)6-7-11-4-3-5-13-12(11)8-9-14-13/h3-9,14H,1H2,2H3/b7-6+ |
| InChIKey | YSFOEIWMNUWPCJ-VOTSOKGWSA-N |
| XLogP | 3.76 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|