About 4-[(1E)-3-methylbuta-1,3-dienyl]-1H-indole
4-[(1E)-3-methylbuta-1,3-dienyl]-1H-indole (PubChem CID 132505356) has the molecular formula C13H13N
and a molecular weight of 183.25 g/mol. Its IUPAC name is 4-[(1E)-3-methylbuta-1,3-dienyl]-1H-indole.
Molecular Properties
| Compound Name | 4-[(1E)-3-methylbuta-1,3-dienyl]-1H-indole |
| PubChem CID | 132505356 |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 4-[(1E)-3-methylbuta-1,3-dienyl]-1H-indole |
| SMILES | C=C(C)/C=C/c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C13H13N/c1-10(2)6-7-11-4-3-5-13-12(11)8-9-14-13/h3-9,14H,1H2,2H3/b7-6+ |
| InChIKey | YSFOEIWMNUWPCJ-VOTSOKGWSA-N |
| XLogP | 3.76 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1E)-3-methylbuta-1,3-dienyl]-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1E)-3-methylbuta-1,3-dienyl]-1H-indole?
The IUPAC name of 4-[(1E)-3-methylbuta-1,3-dienyl]-1H-indole (CID 132505356) is 4-[(1E)-3-methylbuta-1,3-dienyl]-1H-indole.
What is the SMILES notation for 4-[(1E)-3-methylbuta-1,3-dienyl]-1H-indole?
The canonical SMILES for 4-[(1E)-3-methylbuta-1,3-dienyl]-1H-indole is C=C(C)/C=C/c1cccc2[nH]ccc12.
What is the InChIKey of 4-[(1E)-3-methylbuta-1,3-dienyl]-1H-indole?
The InChIKey is YSFOEIWMNUWPCJ-VOTSOKGWSA-N. The full InChI is InChI=1S/C13H13N/c1-10(2)6-7-11-4-3-5-13-12(11)8-9-14-13/h3-9,14H,1H2,2H3/b7-6+.
What are the key properties of 4-[(1E)-3-methylbuta-1,3-dienyl]-1H-indole?
4-[(1E)-3-methylbuta-1,3-dienyl]-1H-indole has a molecular weight of 183.25 g/mol, XLogP of 3.76, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1E)-3-methylbuta-1,3-dienyl]-1H-indole is sourced from PubChem (CID 132505356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).