C21H17NO3 — CID 68551825
1-(4-hydroxyphenyl)-7-(1H-indol-4-yl)hepta-1,6-diene-3,5-dione (PubChem CID 68551825) has the molecular formula C21H17NO3 and a molecular weight of 331.37 g/mol. Its IUPAC name is 1-(4-hydroxyphenyl)-7-(1H-indol-4-yl)hepta-1,6-diene-3,5-dione.
| Compound Name | 1-(4-hydroxyphenyl)-7-(1H-indol-4-yl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 68551825 |
| Molecular Formula | C21H17NO3 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 1-(4-hydroxyphenyl)-7-(1H-indol-4-yl)hepta-1,6-diene-3,5-dione |
| SMILES | O=C(C=Cc1ccc(O)cc1)CC(=O)C=Cc1cccc2[nH]ccc12 |
| InChI | InChI=1S/C21H17NO3/c23-17-8-4-15(5-9-17)6-10-18(24)14-19(25)11-7-16-2-1-3-21-20(16)12-13-22-21/h1-13,22-23H,14H2 |
| InChIKey | KILWTHZPWFDLSX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|