C20H18O6S — CID 90965604
[2-[7-(4-hydroxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl] methanesulfonate (PubChem CID 90965604) has the molecular formula C20H18O6S and a molecular weight of 386.43 g/mol. Its IUPAC name is [2-[7-(4-hydroxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl] methanesulfonate.
| Compound Name | [2-[7-(4-hydroxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 90965604 |
| Molecular Formula | C20H18O6S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | [2-[7-(4-hydroxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccccc1C=CC(=O)CC(=O)C=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C20H18O6S/c1-27(24,25)26-20-5-3-2-4-16(20)9-13-19(23)14-18(22)12-8-15-6-10-17(21)11-7-15/h2-13,21H,14H2,1H3 |
| InChIKey | BBRULTKECNTFMJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|