C14H21NO4S — CID 21420407
5-(2-methylpropylsulfonyl)-2-propoxybenzamide (PubChem CID 21420407) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is 5-(2-methylpropylsulfonyl)-2-propoxybenzamide.
| Compound Name | 5-(2-methylpropylsulfonyl)-2-propoxybenzamide |
|---|---|
| PubChem CID | 21420407 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 5-(2-methylpropylsulfonyl)-2-propoxybenzamide |
| SMILES | CCCOc1ccc(S(=O)(=O)CC(C)C)cc1C(N)=O |
| InChI | InChI=1S/C14H21NO4S/c1-4-7-19-13-6-5-11(8-12(13)14(15)16)20(17,18)9-10(2)3/h5-6,8,10H,4,7,9H2,1-3H3,(H2,15,16) |
| InChIKey | CBYCXBJBENTNBG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |