C32H52N2O3S — CID 21422442
N-[1-[4-[3-(4-butylphenoxy)propylsulfonyl]phenyl]-3-methylbutyl]-N',N'-dipropylethane-1,2-diamine (PubChem CID 21422442) has the molecular formula C32H52N2O3S and a molecular weight of 544.85 g/mol. Its IUPAC name is N-[1-[4-[3-(4-butylphenoxy)propylsulfonyl]phenyl]-3-methylbutyl]-N',N'-dipropylethane-1,2-diamine.
| Compound Name | N-[1-[4-[3-(4-butylphenoxy)propylsulfonyl]phenyl]-3-methylbutyl]-N',N'-dipropylethane-1,2-diamine |
|---|---|
| PubChem CID | 21422442 |
| Molecular Formula | C32H52N2O3S |
| Molecular Weight | 544.85 g/mol |
| Exact Mass | 544.37 |
| IUPAC Name | N-[1-[4-[3-(4-butylphenoxy)propylsulfonyl]phenyl]-3-methylbutyl]-N',N'-dipropylethane-1,2-diamine |
| SMILES | CCCCc1ccc(OCCCS(=O)(=O)c2ccc(C(CC(C)C)NCCN(CCC)CCC)cc2)cc1 |
| InChI | InChI=1S/C32H52N2O3S/c1-6-9-11-28-12-16-30(17-13-28)37-24-10-25-38(35,36)31-18-14-29(15-19-31)32(26-27(4)5)33-20-23-34(21-7-2)22-8-3/h12-19,27,32-33H,6-11,20-26H2,1-5H3 |
| InChIKey | VQKMNKZYAMNJDP-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.85 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|