About 5-(benzenesulfonyl)-1,2-diphenylindole
5-(benzenesulfonyl)-1,2-diphenylindole (PubChem CID 21424353) has the molecular formula C26H19NO2S
and a molecular weight of 409.51 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-1,2-diphenylindole.
Molecular Properties
| Compound Name | 5-(benzenesulfonyl)-1,2-diphenylindole |
| PubChem CID | 21424353 |
| Molecular Formula | C26H19NO2S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 5-(benzenesulfonyl)-1,2-diphenylindole |
| SMILES | O=S(=O)(c1ccccc1)c1ccc2c(c1)cc(-c1ccccc1)n2-c1ccccc1 |
| InChI | InChI=1S/C26H19NO2S/c28-30(29,23-14-8-3-9-15-23)24-16-17-25-21(18-24)19-26(20-10-4-1-5-11-20)27(25)22-12-6-2-7-13-22/h1-19H |
| InChIKey | HCFWIKDQUCOCLY-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(benzenesulfonyl)-1,2-diphenylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(benzenesulfonyl)-1,2-diphenylindole?
The IUPAC name of 5-(benzenesulfonyl)-1,2-diphenylindole (CID 21424353) is 5-(benzenesulfonyl)-1,2-diphenylindole.
What is the SMILES notation for 5-(benzenesulfonyl)-1,2-diphenylindole?
The canonical SMILES for 5-(benzenesulfonyl)-1,2-diphenylindole is O=S(=O)(c1ccccc1)c1ccc2c(c1)cc(-c1ccccc1)n2-c1ccccc1.
What is the InChIKey of 5-(benzenesulfonyl)-1,2-diphenylindole?
The InChIKey is HCFWIKDQUCOCLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H19NO2S/c28-30(29,23-14-8-3-9-15-23)24-16-17-25-21(18-24)19-26(20-10-4-1-5-11-20)27(25)22-12-6-2-7-13-22/h1-19H.
What are the key properties of 5-(benzenesulfonyl)-1,2-diphenylindole?
5-(benzenesulfonyl)-1,2-diphenylindole has a molecular weight of 409.51 g/mol, XLogP of 6.13, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(benzenesulfonyl)-1,2-diphenylindole is sourced from PubChem (CID 21424353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).