C26H19NO2S — CID 21424353
5-(benzenesulfonyl)-1,2-diphenylindole (PubChem CID 21424353) has the molecular formula C26H19NO2S and a molecular weight of 409.51 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-1,2-diphenylindole.
| Compound Name | 5-(benzenesulfonyl)-1,2-diphenylindole |
|---|---|
| PubChem CID | 21424353 |
| Molecular Formula | C26H19NO2S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 5-(benzenesulfonyl)-1,2-diphenylindole |
| SMILES | O=S(=O)(c1ccccc1)c1ccc2c(c1)cc(-c1ccccc1)n2-c1ccccc1 |
| InChI | InChI=1S/C26H19NO2S/c28-30(29,23-14-8-3-9-15-23)24-16-17-25-21(18-24)19-26(20-10-4-1-5-11-20)27(25)22-12-6-2-7-13-22/h1-19H |
| InChIKey | HCFWIKDQUCOCLY-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |