C15H21NO4 — CID 21426069
ethyl 2-[[2-methyl-2-(4-methylphenoxy)propanoyl]amino]acetate (PubChem CID 21426069) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is ethyl 2-[[2-methyl-2-(4-methylphenoxy)propanoyl]amino]acetate.
| Compound Name | ethyl 2-[[2-methyl-2-(4-methylphenoxy)propanoyl]amino]acetate |
|---|---|
| PubChem CID | 21426069 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | ethyl 2-[[2-methyl-2-(4-methylphenoxy)propanoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)C(C)(C)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C15H21NO4/c1-5-19-13(17)10-16-14(18)15(3,4)20-12-8-6-11(2)7-9-12/h6-9H,5,10H2,1-4H3,(H,16,18) |
| InChIKey | LHTJANFRZFJTQP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |