C12H12Cl2FNO3 — CID 21427650
methyl 2-(2,6-dichloro-N-(2-fluoroacetyl)anilino)propanoate (PubChem CID 21427650) has the molecular formula C12H12Cl2FNO3 and a molecular weight of 308.14 g/mol. Its IUPAC name is methyl 2-(2,6-dichloro-N-(2-fluoroacetyl)anilino)propanoate.
| Compound Name | methyl 2-(2,6-dichloro-N-(2-fluoroacetyl)anilino)propanoate |
|---|---|
| PubChem CID | 21427650 |
| Molecular Formula | C12H12Cl2FNO3 |
| Molecular Weight | 308.14 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | methyl 2-(2,6-dichloro-N-(2-fluoroacetyl)anilino)propanoate |
| SMILES | COC(=O)C(C)N(C(=O)CF)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H12Cl2FNO3/c1-7(12(18)19-2)16(10(17)6-15)11-8(13)4-3-5-9(11)14/h3-5,7H,6H2,1-2H3 |
| InChIKey | ULYDGCVHDXHIHR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.14 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |