C13H16O4S — CID 21433203
diethyl 4-methyl-3-sulfanylbenzene-1,2-dicarboxylate (PubChem CID 21433203) has the molecular formula C13H16O4S and a molecular weight of 268.33 g/mol. Its IUPAC name is diethyl 4-methyl-3-sulfanylbenzene-1,2-dicarboxylate.
| Compound Name | diethyl 4-methyl-3-sulfanylbenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 21433203 |
| Molecular Formula | C13H16O4S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | diethyl 4-methyl-3-sulfanylbenzene-1,2-dicarboxylate |
| SMILES | CCOC(=O)c1ccc(C)c(S)c1C(=O)OCC |
| InChI | InChI=1S/C13H16O4S/c1-4-16-12(14)9-7-6-8(3)11(18)10(9)13(15)17-5-2/h6-7,18H,4-5H2,1-3H3 |
| InChIKey | XITVDINUCSZRNW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|