C20H28O2S — CID 21433402
3-butylsulfanyl-6,6,9-trimethyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol (PubChem CID 21433402) has the molecular formula C20H28O2S and a molecular weight of 332.51 g/mol. Its IUPAC name is 3-butylsulfanyl-6,6,9-trimethyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol.
| Compound Name | 3-butylsulfanyl-6,6,9-trimethyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 21433402 |
| Molecular Formula | C20H28O2S |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 3-butylsulfanyl-6,6,9-trimethyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
| SMILES | CCCCSc1cc(O)c2c(c1)OC(C)(C)C1CCC(C)=CC21 |
| InChI | InChI=1S/C20H28O2S/c1-5-6-9-23-14-11-17(21)19-15-10-13(2)7-8-16(15)20(3,4)22-18(19)12-14/h10-12,15-16,21H,5-9H2,1-4H3 |
| InChIKey | DYQICAAWLUMJNJ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|