C16H19BO2 — CID 164541274
CID 164541274 (PubChem CID 164541274) has the molecular formula C16H19BO2 and a molecular weight of 254.14 g/mol.
| Compound Name | CID 164541274 |
|---|---|
| PubChem CID | 164541274 |
| Molecular Formula | C16H19BO2 |
| Molecular Weight | 254.14 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | — |
| SMILES | [B]c1cc(O)c2c(c1)OC(C)(C)[C@@H]1CCC(C)=CC21 |
| InChI | InChI=1S/C16H19BO2/c1-9-4-5-12-11(6-9)15-13(18)7-10(17)8-14(15)19-16(12,2)3/h6-8,11-12,18H,4-5H2,1-3H3/t11?,12-/m1/s1 |
| InChIKey | KVLUJJYBPLZTGE-PIJUOVFKSA-N |
| XLogP | 2.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.14 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|