C12H15ClO5S — CID 21435191
1-chloro-4-methoxybenzene;3-sulfanylpentanedioic acid (PubChem CID 21435191) has the molecular formula C12H15ClO5S and a molecular weight of 306.77 g/mol. Its IUPAC name is 1-chloro-4-methoxybenzene;3-sulfanylpentanedioic acid.
| Compound Name | 1-chloro-4-methoxybenzene;3-sulfanylpentanedioic acid |
|---|---|
| PubChem CID | 21435191 |
| Molecular Formula | C12H15ClO5S |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 1-chloro-4-methoxybenzene;3-sulfanylpentanedioic acid |
| SMILES | COc1ccc(Cl)cc1.O=C(O)CC(S)CC(=O)O |
| InChI | InChI=1S/C7H7ClO.C5H8O4S/c1-9-7-4-2-6(8)3-5-7;6-4(7)1-3(10)2-5(8)9/h2-5H,1H3;3,10H,1-2H2,(H,6,7)(H,8,9) |
| InChIKey | YUHMIWJAFYGOHG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|