C20H16ClN3O3 — CID 21436069
2-[1-(7-chloroquinazolin-4-yl)-5-methoxy-2-methylindol-4-yl]acetic acid (PubChem CID 21436069) has the molecular formula C20H16ClN3O3 and a molecular weight of 381.82 g/mol. Its IUPAC name is 2-[1-(7-chloroquinazolin-4-yl)-5-methoxy-2-methylindol-4-yl]acetic acid.
| Compound Name | 2-[1-(7-chloroquinazolin-4-yl)-5-methoxy-2-methylindol-4-yl]acetic acid |
|---|---|
| PubChem CID | 21436069 |
| Molecular Formula | C20H16ClN3O3 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 2-[1-(7-chloroquinazolin-4-yl)-5-methoxy-2-methylindol-4-yl]acetic acid |
| SMILES | COc1ccc2c(cc(C)n2-c2ncnc3cc(Cl)ccc23)c1CC(=O)O |
| InChI | InChI=1S/C20H16ClN3O3/c1-11-7-14-15(9-19(25)26)18(27-2)6-5-17(14)24(11)20-13-4-3-12(21)8-16(13)22-10-23-20/h3-8,10H,9H2,1-2H3,(H,25,26) |
| InChIKey | OTOFUYBZVYLVHD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |