C26H20ClN3O3 — CID 21449391
phenyl 2-[1-(7-chloroquinazolin-4-yl)-5-methoxy-2-methylindol-3-yl]acetate (PubChem CID 21449391) has the molecular formula C26H20ClN3O3 and a molecular weight of 457.92 g/mol. Its IUPAC name is phenyl 2-[1-(7-chloroquinazolin-4-yl)-5-methoxy-2-methylindol-3-yl]acetate.
| Compound Name | phenyl 2-[1-(7-chloroquinazolin-4-yl)-5-methoxy-2-methylindol-3-yl]acetate |
|---|---|
| PubChem CID | 21449391 |
| Molecular Formula | C26H20ClN3O3 |
| Molecular Weight | 457.92 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | phenyl 2-[1-(7-chloroquinazolin-4-yl)-5-methoxy-2-methylindol-3-yl]acetate |
| SMILES | COc1ccc2c(c1)c(CC(=O)Oc1ccccc1)c(C)n2-c1ncnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C26H20ClN3O3/c1-16-21(14-25(31)33-18-6-4-3-5-7-18)22-13-19(32-2)9-11-24(22)30(16)26-20-10-8-17(27)12-23(20)28-15-29-26/h3-13,15H,14H2,1-2H3 |
| InChIKey | RQQWXUQXVNZPLD-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.92 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|