C15H12ClNO3 — CID 21437821
bicyclo[4.1.0]hepta-1,3,5-trien-7-one;methyl N-chloro-N-phenylcarbamate (PubChem CID 21437821) has the molecular formula C15H12ClNO3 and a molecular weight of 289.72 g/mol. Its IUPAC name is bicyclo[4.1.0]hepta-1,3,5-trien-7-one;methyl N-chloro-N-phenylcarbamate.
| Compound Name | bicyclo[4.1.0]hepta-1,3,5-trien-7-one;methyl N-chloro-N-phenylcarbamate |
|---|---|
| PubChem CID | 21437821 |
| Molecular Formula | C15H12ClNO3 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | bicyclo[4.1.0]hepta-1,3,5-trien-7-one;methyl N-chloro-N-phenylcarbamate |
| SMILES | COC(=O)N(Cl)c1ccccc1.O=c1c2ccccc12 |
| InChI | InChI=1S/C8H8ClNO2.C7H4O/c1-12-8(11)10(9)7-5-3-2-4-6-7;8-7-5-3-1-2-4-6(5)7/h2-6H,1H3;1-4H |
| InChIKey | DTVLQIQIYRQATQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|