C13H23N4O3S+ — CID 21442090
methylcarbamoyl-propan-2-yl-(C-prop-2-enoxycarbonimidoyl)-(prop-2-enylsulfanylcarbamoyl)azanium (PubChem CID 21442090) has the molecular formula C13H23N4O3S+ and a molecular weight of 315.42 g/mol. Its IUPAC name is methylcarbamoyl-propan-2-yl-(C-prop-2-enoxycarbonimidoyl)-(prop-2-enylsulfanylcarbamoyl)azanium.
| Compound Name | methylcarbamoyl-propan-2-yl-(C-prop-2-enoxycarbonimidoyl)-(prop-2-enylsulfanylcarbamoyl)azanium |
|---|---|
| PubChem CID | 21442090 |
| Molecular Formula | C13H23N4O3S+ |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | methylcarbamoyl-propan-2-yl-(C-prop-2-enoxycarbonimidoyl)-(prop-2-enylsulfanylcarbamoyl)azanium |
| SMILES | [H]/N=C(\OCC=C)[N+](C(=O)NC)(C(=O)NSCC=C)C(C)C |
| InChI | InChI=1S/C13H22N4O3S/c1-6-8-20-11(14)17(10(3)4,12(18)15-5)13(19)16-21-9-7-2/h6-7,10,14H,1-2,8-9H2,3-5H3,(H-,15,16,18,19)/p+1/b14-11- |
| InChIKey | WNBDXHABMGWFPK-KAMYIIQDSA-O |
| XLogP | 2.23 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|